CAS 99458-15-8 is the registry number for Methyl (alphaR,betaS)-beta-Azido-alpha-hydroxybenzenepropanoate. Offered by: TRC. Available pack sizes: 100mg.
Methyl (2R,3S)-3-azido-2-hydroxy-3-phenylpropanoate (CAS 99458-15-8) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: methyl (2R,3S)-3-azido-2-hydroxy-3-phenylpropanoate. InChIKey: VLKYMHSOQDMQNF-DTWKUNHWSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | methyl (2R,3S)-3-azido-2-hydroxy-3-phenylpropanoate |
| InChIKey | VLKYMHSOQDMQNF-DTWKUNHWSA-N |
| SMILES | COC(=O)[C@@H]([C@H](C1=CC=CC=C1)N=[N+]=[N-])O |
Computed by PubChem (NCBI)