cas: 1280786-59-5 — see every product listed under this CAS number, including other names
tert-Butyl 6-chloropicolinate 96% (CAS 1280786-59-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A678824-250mg |
| cas | 1280786-59-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 1227.00 Pln | |
| Ambeed | 10g | 2155.94 Pln | |
| Ambeed | 25g | 4236.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A678824 |
Tert-butyl 6-chloropyridine-2-carboxylate (CAS 1280786-59-5) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: tert-butyl 6-chloropyridine-2-carboxylate. InChIKey: DVPHJLOQDYBPAW-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | tert-butyl 6-chloropyridine-2-carboxylate |
| InChIKey | DVPHJLOQDYBPAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=NC(=CC=C1)Cl |
Computed by PubChem (NCBI)