cas: 5153-73-1 — see every product listed under this CAS number, including other names
trans-4-(2-Nitroethenyl)benzonitrile 98% (CAS 5153-73-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A525995-1g |
| cas | 5153-73-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 626.25 Pln | |
| Ambeed | 5g | 1594.12 Pln | |
| Ambeed | 25g | 4675.75 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 10g | 2361.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A525995 |
4-[(E)-2-nitroethenyl]benzonitrile (CAS 5153-73-1) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 4-[(E)-2-nitroethenyl]benzonitrile. InChIKey: CVWPMONBGNBYCJ-AATRIKPKSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 4-[(E)-2-nitroethenyl]benzonitrile |
| InChIKey | CVWPMONBGNBYCJ-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)