cas: 2688-90-6 — see every product listed under this CAS number, including other names
(1,1'-Biphenyl)-2-sulfonyl chloride, 97% (CAS 2688-90-6) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A106188-10g |
| cas | 2688-90-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 5935.51 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-phenylbenzenesulfonyl chloride (CAS 2688-90-6) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 2-phenylbenzenesulfonyl chloride. InChIKey: RENKNADFNRIRNZ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 2-phenylbenzenesulfonyl chloride |
| InChIKey | RENKNADFNRIRNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)