cas: 2688-90-6 — see every product listed under this CAS number, including other names
Biphenyl-2-sulfonyl chloride, 97% (CAS 2688-90-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014899-100MG |
| cas | 2688-90-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 1g | 794.53 Pln | |
| Fluorochem | 5g | 2189.87 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-phenylbenzenesulfonyl chloride (CAS 2688-90-6) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 2-phenylbenzenesulfonyl chloride. InChIKey: RENKNADFNRIRNZ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 2-phenylbenzenesulfonyl chloride |
| InChIKey | RENKNADFNRIRNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)