cas: 6780-38-7 — see every product listed under this CAS number, including other names
(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)acetyl chloride, 97% (CAS 6780-38-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F370979-5G |
| cas | 6780-38-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 851.80 Pln | |
| Fluorochem | 10g | 1393.28 Pln | |
| Fluorochem | 25g | 2736.55 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(1,3-dioxoisoindol-2-yl)acetyl chloride (CAS 6780-38-7) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)acetyl chloride. InChIKey: RHZBRCQIKQUQHQ-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)acetyl chloride |
| InChIKey | RHZBRCQIKQUQHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC(=O)Cl |
Computed by PubChem (NCBI)