CAS 338982-11-9 appears in our catalog under these names: 3-(4-Chlorophenyl)-1,2-oxazole-5-carboxylic acid, 95%, 3-(4-Chlorophenyl)isoxazole-5-carboxylic acid, 3-(4-Chlorophenyl)isoxazole-5-carboxylic acid, 95%, 95%, 3-(4-Chloro-phenyl)-isoxazole-5-carboxylic acid, 97%, 3-(4-Chlorophenyl)isoxazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 5g, 1g, 250mg, 2,5g, 500mg.
3-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid (CAS 338982-11-9) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: COIATTMFFQMKKS-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | COIATTMFFQMKKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)