CAS 35973-14-9 appears in our catalog under these names: 6-Chloro-4-hydroxyquinoline-3-carboxylic acid, 98%, 6–Chloro–4–hydroxyquinoline–3–carboxylic acid, 6-Chloro-4-hydroxyquinoline-3-carboxylic acid 98%, 6-Chloro-4-hydroxyquinoline-3-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 25g.
6-chloro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 35973-14-9) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 6-chloro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: CDPXSMNKRFLXHU-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 6-chloro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | CDPXSMNKRFLXHU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)