CAS 100517-43-9 appears in our catalog under these names: 3-(3-Chlorophenyl)-1,2-oxazole-5-carboxylic acid, 95%, 3-(3-Chlorophenyl)isoxazole-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g.
3-(3-chlorophenyl)-1,2-oxazole-5-carboxylic acid (CAS 100517-43-9) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 3-(3-chlorophenyl)-1,2-oxazole-5-carboxylic acid. InChIKey: HNYLKRYOMWDUOY-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | HNYLKRYOMWDUOY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NOC(=C2)C(=O)O |
Computed by PubChem (NCBI)