Products 10174-72-8
CAS 10174-72-8 is the registry number for 6-Chloro-4-hydroxyquinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-chloro-4-oxo-1H-quinoline-2-carboxylic acid (CAS 10174-72-8) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 6-chloro-4-oxo-1H-quinoline-2-carboxylic acid. InChIKey: FBHYBXRWVNVMRY-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 6-chloro-4-oxo-1H-quinoline-2-carboxylic acid |
| InChIKey | FBHYBXRWVNVMRY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=O)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)