CAS 380448-07-7 appears in our catalog under these names: 5-Chloro-3-formyl-1h-indole-2-carboxylic acid, 98%, 5-chloro-3-formyl-1H-indole-2-carboxylic acid, 1H-Indole-2-carboxylic acid, 5-chloro-3-formyl-, 95%, 95%, 5-Chloro-3-formyl-1H-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 10g, 250mg, 100mg.
5-chloro-3-formyl-1H-indole-2-carboxylic acid (CAS 380448-07-7) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 5-chloro-3-formyl-1H-indole-2-carboxylic acid. InChIKey: RLWPMCOCDJKMEY-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 5-chloro-3-formyl-1H-indole-2-carboxylic acid |
| InChIKey | RLWPMCOCDJKMEY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=C(N2)C(=O)O)C=O |
Computed by PubChem (NCBI)