Products 1154742-55-8
CAS 1154742-55-8 is the registry number for 1H-Indole-3-acetic acid, 4-chloro-alpha-oxo-, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(4-chloro-1H-indol-3-yl)-2-oxoacetic acid (CAS 1154742-55-8) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 2-(4-chloro-1H-indol-3-yl)-2-oxoacetic acid. InChIKey: HUSBDMYWWGMONW-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 2-(4-chloro-1H-indol-3-yl)-2-oxoacetic acid |
| InChIKey | HUSBDMYWWGMONW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=CN2)C(=O)C(=O)O |
Computed by PubChem (NCBI)