cas: 1346526-56-4 — see every product listed under this CAS number, including other names
(1-Oxoisoindolin-5-yl)boronic acid, 95% (CAS 1346526-56-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F768811-1G |
| cas | 1346526-56-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3153.07 Pln | |
| Fluorochem | 5g | 9275.92 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(1-oxo-2,3-dihydroisoindol-5-yl)boronic acid (CAS 1346526-56-4) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (1-oxo-2,3-dihydroisoindol-5-yl)boronic acid. InChIKey: PHNVHDUWRDWRJL-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (1-oxo-2,3-dihydroisoindol-5-yl)boronic acid |
| InChIKey | PHNVHDUWRDWRJL-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C(=O)NC2)(O)O |
Computed by PubChem (NCBI)