cas: 1346526-56-4 — see every product listed under this CAS number, including other names
1-Oxoisoindolin-5-ylboronic acid, 97%, 97% (CAS 1346526-56-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNXA-100mg |
| cas | 1346526-56-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 904.40 Pln | |
| Chemat | 250mg | 1259.60 Pln | |
| Chemat | 1g | 2445.20 Pln | |
| Chemat | 5g | 7192.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1-oxo-2,3-dihydroisoindol-5-yl)boronic acid (CAS 1346526-56-4) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (1-oxo-2,3-dihydroisoindol-5-yl)boronic acid. InChIKey: PHNVHDUWRDWRJL-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (1-oxo-2,3-dihydroisoindol-5-yl)boronic acid |
| InChIKey | PHNVHDUWRDWRJL-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C(=O)NC2)(O)O |
Computed by PubChem (NCBI)