cas: 46022-05-3 — see every product listed under this CAS number, including other names
(1R,2R)-1,2-Cyclohexanedicarboxylic Acid, >98.0%(GC)(T) (CAS 46022-05-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C1953-1G |
| cas | 46022-05-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 265.86 Pln | |
| TCI | 5g | 993.62 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
Trans-(1R,2R)-cyclohexane-1,2-dicarboxylic acid (CAS 46022-05-3) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1R,2R)-cyclohexane-1,2-dicarboxylic acid. InChIKey: QSAWQNUELGIYBC-PHDIDXHHSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1R,2R)-cyclohexane-1,2-dicarboxylic acid |
| InChIKey | QSAWQNUELGIYBC-PHDIDXHHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)