cas: 46022-05-3 — see every product listed under this CAS number, including other names
(1R,2R)-Cyclohexane-1,2-dicarboxylic acid, 98%, 98% (CAS 46022-05-3) is a chemical reagent available from Chemat. Available pack sizes: 250g, 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9K3-250g |
| cas | 46022-05-3 |
| size | 250g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 448.40 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 50g | 146.00 Pln | |
| Chemat | 100g | 218.00 Pln | |
| Chemat | 500g | 902.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2R)-cyclohexane-1,2-dicarboxylic acid (CAS 46022-05-3) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1R,2R)-cyclohexane-1,2-dicarboxylic acid. InChIKey: QSAWQNUELGIYBC-PHDIDXHHSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1R,2R)-cyclohexane-1,2-dicarboxylic acid |
| InChIKey | QSAWQNUELGIYBC-PHDIDXHHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)