cas: 46022-05-3 — see every product listed under this CAS number, including other names
(1R,2R)-Cyclohexane-1,2-dicarboxylic Acid, 97% (CAS 46022-05-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F601552-10G |
| cas | 46022-05-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 96.86 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 185.37 Pln | |
| Fluorochem | 500g | 612.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Trans-(1R,2R)-cyclohexane-1,2-dicarboxylic acid (CAS 46022-05-3) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1R,2R)-cyclohexane-1,2-dicarboxylic acid. InChIKey: QSAWQNUELGIYBC-PHDIDXHHSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1R,2R)-cyclohexane-1,2-dicarboxylic acid |
| InChIKey | QSAWQNUELGIYBC-PHDIDXHHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)