cas: 190903-71-0 — see every product listed under this CAS number, including other names
(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)boronic acid 97% (CAS 190903-71-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1490462-100mg |
| cas | 190903-71-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 832.06 Pln | |
| Ambeed | 25g | 2612.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1490462 |
(2,2-difluoro-1,3-benzodioxol-5-yl)boronic acid (CAS 190903-71-0) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-5-yl)boronic acid. InChIKey: OTTIPUIRDXSIBG-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O4 |
|---|---|
| Molecular weight | 201.92 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-5-yl)boronic acid |
| InChIKey | OTTIPUIRDXSIBG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OC(O2)(F)F)(O)O |
Computed by PubChem (NCBI)