cas: 190903-71-0 — see every product listed under this CAS number, including other names
(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)boronic acid, 98%, 98% (CAS 190903-71-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113EWM-1g |
| cas | 190903-71-0 |
| size | 1g |
| availability | 53.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 222.80 Pln | |
| Chemat | 25g | 362.00 Pln | |
| Chemat | 50g | 630.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,2-difluoro-1,3-benzodioxol-5-yl)boronic acid (CAS 190903-71-0) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-5-yl)boronic acid. InChIKey: OTTIPUIRDXSIBG-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O4 |
|---|---|
| Molecular weight | 201.92 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-5-yl)boronic acid |
| InChIKey | OTTIPUIRDXSIBG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OC(O2)(F)F)(O)O |
Computed by PubChem (NCBI)