CAS 1966890-13-0 appears in our catalog under these names: 4-Carboxy-2,5-difluorophenylboronic acid, 98%, 4-Borono-2,5-difluorobenzoic acid, 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
4-borono-2,5-difluorobenzoic acid (CAS 1966890-13-0) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: 4-borono-2,5-difluorobenzoic acid. InChIKey: KXZZPNXACSXLNV-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O4 |
|---|---|
| Molecular weight | 201.92 g/mol |
| IUPAC name | 4-borono-2,5-difluorobenzoic acid |
| InChIKey | KXZZPNXACSXLNV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)C(=O)O)F)(O)O |
Computed by PubChem (NCBI)