CAS 1031857-98-3 appears in our catalog under these names: 4-Borono-3,5-difluorobenzoic acid, 98%, 98%, 4-Borono-3,5-difluorobenzoic acid, 98%, 4-Borono-3,5-difluorobenzoic acid, 97%, 4–Borono–3,5–difluorobenzoic acid. Offered by: Chemat, Fluorochem, Ambeed, Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-borono-3,5-difluorobenzoic acid (CAS 1031857-98-3) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: 4-borono-3,5-difluorobenzoic acid. InChIKey: QJZJINMQKWVLJB-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O4 |
|---|---|
| Molecular weight | 201.92 g/mol |
| IUPAC name | 4-borono-3,5-difluorobenzoic acid |
| InChIKey | QJZJINMQKWVLJB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)C(=O)O)F)(O)O |
Computed by PubChem (NCBI)