CAS 190903-71-0 appears in our catalog under these names: 2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid, 98%, 2,2-Difluoro-benzo(1,3)dioxole-5-boronic acid, 95-<97%, 2,2-Difluoro-benzo(1,3)dioxole-5-boronic acid, ≥97-<99%, 2,2-Difluoro-1,3-Benzodioxol-5-Ylboronic Acid, (2,2-Difluorobenzo[d][1,3]dioxol-5-yl)boronic acid 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 25g, 50g, 100g, 200g.
(2,2-difluoro-1,3-benzodioxol-5-yl)boronic acid (CAS 190903-71-0) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-5-yl)boronic acid. InChIKey: OTTIPUIRDXSIBG-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O4 |
|---|---|
| Molecular weight | 201.92 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-5-yl)boronic acid |
| InChIKey | OTTIPUIRDXSIBG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OC(O2)(F)F)(O)O |
Computed by PubChem (NCBI)