cas: 190903-71-0 — see every product listed under this CAS number, including other names
(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)boronic acid, 95% (CAS 190903-71-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210479-100MG |
| cas | 190903-71-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 500mg | 341.56 Pln | |
| Fluorochem | 1g | 435.28 Pln | |
| Fluorochem | 5g | 976.76 Pln | |
| Fluorochem | 10g | 1903.51 Pln | |
| Fluorochem | 25g | 3153.07 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2,2-difluoro-1,3-benzodioxol-5-yl)boronic acid (CAS 190903-71-0) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-5-yl)boronic acid. InChIKey: OTTIPUIRDXSIBG-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O4 |
|---|---|
| Molecular weight | 201.92 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-5-yl)boronic acid |
| InChIKey | OTTIPUIRDXSIBG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OC(O2)(F)F)(O)O |
Computed by PubChem (NCBI)