Products 2377605-76-8
CAS 2377605-76-8 appears in our catalog under these names: 5-Carboxy-2,3-difluorophenylboronic acid, 96%, 3-Borono-4,5-difluorobenzoic acid 97%, 5-Carboxy-2,3-difluorophenylboronic acid, 97%, 97%, 5-Carboxy-2,3-difluorophenylboronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
3-borono-4,5-difluorobenzoic acid (CAS 2377605-76-8) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: 3-borono-4,5-difluorobenzoic acid. InChIKey: LPIWMNPBZLPGJH-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O4 |
|---|---|
| Molecular weight | 201.92 g/mol |
| IUPAC name | 3-borono-4,5-difluorobenzoic acid |
| InChIKey | LPIWMNPBZLPGJH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)F)C(=O)O)(O)O |
Computed by PubChem (NCBI)