CAS 1029716-94-6 appears in our catalog under these names: 3,5-Difluoro-4-carboxyphenylboronic acid, 96%, 3,5-Difluoro-4-carboxyphenylboronic acid, 96%, 96%, 4-Borono-2,6-difluorobenzoic acid, 98%, 4-Borono-2,6-difluorobenzoic acid, 96%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
4-borono-2,6-difluorobenzoic acid (CAS 1029716-94-6) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: 4-borono-2,6-difluorobenzoic acid. InChIKey: AWIXNRNZROUJQB-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O4 |
|---|---|
| Molecular weight | 201.92 g/mol |
| IUPAC name | 4-borono-2,6-difluorobenzoic acid |
| InChIKey | AWIXNRNZROUJQB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)C(=O)O)F)(O)O |
Computed by PubChem (NCBI)