Products 1217500-81-6
CAS 1217500-81-6 appears in our catalog under these names: 3-Carboxy-4,5-difluorophenylboronic acid, 98%, 3-Carboxy-4,5-difluorophenylboronic acid, 96%, 5-Borono-2,3-difluorobenzoic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
5-borono-2,3-difluorobenzoic acid (CAS 1217500-81-6) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: 5-borono-2,3-difluorobenzoic acid. InChIKey: LGTXKMKWZQXDKJ-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O4 |
|---|---|
| Molecular weight | 201.92 g/mol |
| IUPAC name | 5-borono-2,3-difluorobenzoic acid |
| InChIKey | LGTXKMKWZQXDKJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)C(=O)O)(O)O |
Computed by PubChem (NCBI)