Products 2377609-91-9

CAS 2377609-91-9 is the registry number for 6-Carboxy-2,3-difluorophenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-borono-3,4-difluorobenzoic acid (CAS 2377609-91-9) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: 2-borono-3,4-difluorobenzoic acid. InChIKey: CPTUBAZQYZDBRU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BF2O4
Molecular weight201.92 g/mol
IUPAC name2-borono-3,4-difluorobenzoic acid
InChIKeyCPTUBAZQYZDBRU-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1F)F)C(=O)O)(O)O

Computed by PubChem (NCBI)