CAS 1029716-92-4 appears in our catalog under these names: 4–Borono–2,3–difluorobenzoic acid, 4-Borono-2,3-difluorobenzoic acid, 97%, 4-Borono-2,3-difluorobenzoic acid, 95%, 4-Borono-2,3-difluorobenzoic acid, 95%, 95%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-borono-2,3-difluorobenzoic acid (CAS 1029716-92-4) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: 4-borono-2,3-difluorobenzoic acid. InChIKey: GBSLWLRHCRIIKW-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O4 |
|---|---|
| Molecular weight | 201.92 g/mol |
| IUPAC name | 4-borono-2,3-difluorobenzoic acid |
| InChIKey | GBSLWLRHCRIIKW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C(=O)O)F)F)(O)O |
Computed by PubChem (NCBI)