CAS 126120-87-4 appears in our catalog under these names: (2,2-Difluorobenzodioxol-4-yl)boronic acid, 98%, 98%, (2,2-Difluorobenzo[d][1,3]dioxol-4-yl)boronic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(2,2-difluoro-1,3-benzodioxol-4-yl)boronic acid (CAS 126120-87-4) is a chemical compound with the molecular formula C7H5BF2O4 and a molecular weight of 201.92 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-4-yl)boronic acid. InChIKey: GCIIKWAIWSFGLA-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O4 |
|---|---|
| Molecular weight | 201.92 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-4-yl)boronic acid |
| InChIKey | GCIIKWAIWSFGLA-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)OC(O2)(F)F)(O)O |
Computed by PubChem (NCBI)