cas: 480424-84-8 — see every product listed under this CAS number, including other names
(2,3-Difluoro-4-formylphenyl)boronic acid 98% (CAS 480424-84-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A466812-1g |
| cas | 480424-84-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 515.00 Pln | |
| Ambeed | 10g | 832.06 Pln | |
| Ambeed | 25g | 1588.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A466812 |
(2,3-difluoro-4-formylphenyl)boronic acid (CAS 480424-84-8) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (2,3-difluoro-4-formylphenyl)boronic acid. InChIKey: LZNNBOWURANFDS-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (2,3-difluoro-4-formylphenyl)boronic acid |
| InChIKey | LZNNBOWURANFDS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C=O)F)F)(O)O |
Computed by PubChem (NCBI)