cas: 480424-84-8 — see every product listed under this CAS number, including other names
2,3-Difluoro-4-formylphenylboronic acid, 97%, 97% (CAS 480424-84-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FI6-100mg |
| cas | 480424-84-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 458.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,3-difluoro-4-formylphenyl)boronic acid (CAS 480424-84-8) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (2,3-difluoro-4-formylphenyl)boronic acid. InChIKey: LZNNBOWURANFDS-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (2,3-difluoro-4-formylphenyl)boronic acid |
| InChIKey | LZNNBOWURANFDS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C=O)F)F)(O)O |
Computed by PubChem (NCBI)