(2,5-Difluoro-4-methoxyphenyl)boronic acid 95%
cas: 897958-93-9 — see every product listed under this CAS number, including other names
(2,5-Difluoro-4-methoxyphenyl)boronic acid 95% (CAS 897958-93-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A610974-100g |
| cas | 897958-93-9 |
| size | 100g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 14821.75 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1299.31 Pln | |
| Ambeed | 10g | 2372.88 Pln | |
| Ambeed | 25g | 4681.31 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A610974 |
(2,5-difluoro-4-methoxyphenyl)boronic acid (CAS 897958-93-9) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,5-difluoro-4-methoxyphenyl)boronic acid. InChIKey: BRMUXDWCSVTVPQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,5-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | BRMUXDWCSVTVPQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,5-Difluoro-4-methoxyphenylboronic acid, (2,5-difluoro-4-methoxyphenyl)boronic acid, (2,5-difluoro-4-methoxy-phenyl)boronic Acid, (2,5-difluoro-4-methoxyphenyl)boronicacid, [2,5-difluoro-4-(methyloxy)phenyl]boronic acid, 2,5-Difluoro-4-methoxyphenylboronic acid(contains varying amounts of anhydride)