(2,5-Difluoro-4-methoxyphenyl)boronic acid, 97%
cas: 897958-93-9 — see every product listed under this CAS number, including other names
(2,5-Difluoro-4-methoxyphenyl)boronic acid, 97% (CAS 897958-93-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210025-100MG |
| cas | 897958-93-9 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 1226.67 Pln | |
| Fluorochem | 10g | 2257.56 Pln | |
| Fluorochem | 25g | 4548.42 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-difluoro-4-methoxyphenyl)boronic acid (CAS 897958-93-9) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,5-difluoro-4-methoxyphenyl)boronic acid. InChIKey: BRMUXDWCSVTVPQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,5-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | BRMUXDWCSVTVPQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,5-Difluoro-4-methoxyphenylboronic acid, (2,5-difluoro-4-methoxyphenyl)boronic acid, (2,5-difluoro-4-methoxy-phenyl)boronic Acid, (2,5-difluoro-4-methoxyphenyl)boronicacid, [2,5-difluoro-4-(methyloxy)phenyl]boronic acid, 2,5-Difluoro-4-methoxyphenylboronic acid(contains varying amounts of anhydride)