cas: 1150114-56-9 — see every product listed under this CAS number, including other names
(2-(Benzyloxy)-3,5-difluorophenyl)boronic acid, 98% (CAS 1150114-56-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A169725-100mg |
| cas | 1150114-56-9 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 499.66 Pln | |
| AmBeed | 250mg | 786.10 Pln | |
| Fluorochem | 100mg | 383.22 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3,5-difluoro-2-phenylmethoxyphenyl)boronic acid (CAS 1150114-56-9) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (3,5-difluoro-2-phenylmethoxyphenyl)boronic acid. InChIKey: IHFUXROSLRIZDZ-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (3,5-difluoro-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | IHFUXROSLRIZDZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OCC2=CC=CC=C2)F)F)(O)O |
Computed by PubChem (NCBI)