CAS 1451393-19-3 appears in our catalog under these names: 6-(benzyloxy)-2,3-difluorophenylboronic acid, 97%, (6–(Benzyloxy)–2,3–difluorophenyl)boronic acid, (6-(Benzyloxy)-2,3-difluorophenyl)boronic acid 97%, 6-(benzyloxy)-2,3-difluorophenylboronic acid, 97%, 97%, (6-(Benzyloxy)-2,3-difluorophenyl)boronic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 250mg.
(2,3-difluoro-6-phenylmethoxyphenyl)boronic acid (CAS 1451393-19-3) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (2,3-difluoro-6-phenylmethoxyphenyl)boronic acid. InChIKey: SLVNSQQTZBWDTP-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (2,3-difluoro-6-phenylmethoxyphenyl)boronic acid |
| InChIKey | SLVNSQQTZBWDTP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)F)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)