CAS 1452574-01-4 appears in our catalog under these names: 2,5-Difluoro-4-benzyloxyphenylboronic acid, 95%, (4-(Benzyloxy)-2,5-difluorophenyl)boronic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
(2,5-difluoro-4-phenylmethoxyphenyl)boronic acid (CAS 1452574-01-4) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (2,5-difluoro-4-phenylmethoxyphenyl)boronic acid. InChIKey: HLUICRYLUTUUEO-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (2,5-difluoro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | HLUICRYLUTUUEO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)OCC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)