CAS 2121512-14-7 appears in our catalog under these names: 2-Benzyloxy-4,5-difluorophenylboronic acid, 98%, 2-Benzyloxy-4,5-difluorophenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g.
(4,5-difluoro-2-phenylmethoxyphenyl)boronic acid (CAS 2121512-14-7) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (4,5-difluoro-2-phenylmethoxyphenyl)boronic acid. InChIKey: HRHVFXMMMRJAAW-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (4,5-difluoro-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | HRHVFXMMMRJAAW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OCC2=CC=CC=C2)F)F)(O)O |
Computed by PubChem (NCBI)