Products 1256355-76-6
CAS 1256355-76-6 appears in our catalog under these names: 4-[(2,3-difluorophenyl)methoxy]phenylboronic acid, 98%, (4-((2,3-Difluorobenzyl)oxy)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
[4-[(2,3-difluorophenyl)methoxy]phenyl]boronic acid (CAS 1256355-76-6) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: [4-[(2,3-difluorophenyl)methoxy]phenyl]boronic acid. InChIKey: IGHRKMDUIARIJF-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | [4-[(2,3-difluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | IGHRKMDUIARIJF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=C(C(=CC=C2)F)F)(O)O |
Computed by PubChem (NCBI)