cas: 1315339-48-0 — see every product listed under this CAS number, including other names
(2-Bromo-4,6-difluorophenyl)boronic acid, 98% (CAS 1315339-48-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329289-250MG |
| cas | 1315339-48-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1153.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2-bromo-4,6-difluorophenyl)boronic acid (CAS 1315339-48-0) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (2-bromo-4,6-difluorophenyl)boronic acid. InChIKey: POXLFROUJDNFPQ-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (2-bromo-4,6-difluorophenyl)boronic acid |
| InChIKey | POXLFROUJDNFPQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Br)F)F)(O)O |
Computed by PubChem (NCBI)