Products 1260757-41-2
CAS 1260757-41-2 appears in our catalog under these names: (2-Bromo-3,6-difluorophenyl)boronic acid, 98%, (2-Bromo-3,6-difluorophenyl)boronic acid, 95%, 6-Bromo-2,5-difluorophenylboronic acid, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-bromo-3,6-difluorophenyl)boronic acid (CAS 1260757-41-2) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (2-bromo-3,6-difluorophenyl)boronic acid. InChIKey: CVXDUHUMVYJZPU-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (2-bromo-3,6-difluorophenyl)boronic acid |
| InChIKey | CVXDUHUMVYJZPU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Br)F)F)(O)O |
Computed by PubChem (NCBI)