CAS 374790-99-5 appears in our catalog under these names: 4-BROMO-2,3-DIFLUOROBENZENEBORONIC ACID, 97%, 97%, 4-Bromo-2,3-difluorophenylboronic acid, 97%, 4-Bromo-2,3-difluorobenzeneboronic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(4-bromo-2,3-difluorophenyl)boronic acid (CAS 374790-99-5) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (4-bromo-2,3-difluorophenyl)boronic acid. InChIKey: CUTKSWXGYLUSCY-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (4-bromo-2,3-difluorophenyl)boronic acid |
| InChIKey | CUTKSWXGYLUSCY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Br)F)F)(O)O |
Computed by PubChem (NCBI)