Products 352535-81-0
CAS 352535-81-0 appears in our catalog under these names: 4–Bromo–2,6–difluorophenylboronic acid(Contains varying amounts of anhydride), 4-Bromo-2,6-difluorophenylboronic acid, 95%, 95%, 4-Bromo-2,6-difluorophenylboronic acid, 98%, 4-Bromo-2,6-difluorophenylboronic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
(4-bromo-2,6-difluorophenyl)boronic acid (CAS 352535-81-0) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (4-bromo-2,6-difluorophenyl)boronic acid. InChIKey: QHYNAULNEIXXPC-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (4-bromo-2,6-difluorophenyl)boronic acid |
| InChIKey | QHYNAULNEIXXPC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)Br)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Bromo-2,6-difluorophenylboronic acid, (4-bromo-2,6-difluorophenyl)boronic acid, 2,6-Difluoro-4-bromophenylboronic acid, (4-bromo-2,6-difluoro-phenyl)boronic Acid, 4-Bromo-2,6-difluorophenylboronic acid(Contains varying amounts of anhydride), 4-Bromo-2,6-difluorophenylboronicacid, (4-Bromo-2,6-difluorophenyl)boronicacid