CAS 2377612-01-4 appears in our catalog under these names: (6-Chloro-5-hydroxypyridin-2-yl)boronic acid pinacol ester, 96%, 2-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ol (CAS 2377612-01-4) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ol. InChIKey: GTJVZXBILGNBMZ-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ol |
| InChIKey | GTJVZXBILGNBMZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)