CAS 2000236-32-6 is the registry number for 2-Chloro-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ol (CAS 2000236-32-6) is a chemical compound with the molecular formula C11H15BClNO3 and a molecular weight of 255.51 g/mol. IUPAC name: 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ol. InChIKey: ZLDYGLVRTCDNEQ-UHFFFAOYSA-N.
| Molecular formula | C11H15BClNO3 |
|---|---|
| Molecular weight | 255.51 g/mol |
| IUPAC name | 2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ol |
| InChIKey | ZLDYGLVRTCDNEQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)Cl)O |
Computed by PubChem (NCBI)