cas: 1051316-38-1 — see every product listed under this CAS number, including other names
(2-Oxoindolin-5-yl)boronic acid, 95%, 95% (CAS 1051316-38-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1104XG-100mg |
| cas | 1051316-38-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 693.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2-oxo-1,3-dihydroindol-5-yl)boronic acid (CAS 1051316-38-1) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (2-oxo-1,3-dihydroindol-5-yl)boronic acid. InChIKey: VKAPDBRYEZFWKT-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (2-oxo-1,3-dihydroindol-5-yl)boronic acid |
| InChIKey | VKAPDBRYEZFWKT-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)NC(=O)C2)(O)O |
Computed by PubChem (NCBI)