cas: 1051316-38-1 — see every product listed under this CAS number, including other names
(2-Oxoindolin-5-yl)boronic acid, 95% (CAS 1051316-38-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F910062-250MG |
| cas | 1051316-38-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 857.01 Pln | |
| Fluorochem | 5g | 3267.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2-oxo-1,3-dihydroindol-5-yl)boronic acid (CAS 1051316-38-1) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (2-oxo-1,3-dihydroindol-5-yl)boronic acid. InChIKey: VKAPDBRYEZFWKT-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (2-oxo-1,3-dihydroindol-5-yl)boronic acid |
| InChIKey | VKAPDBRYEZFWKT-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)NC(=O)C2)(O)O |
Computed by PubChem (NCBI)