(3,5-Dichloro-4-methoxyphenyl),boronic acid, 98%, 98%
cas: 175883-61-1 — see every product listed under this CAS number, including other names
(3,5-Dichloro-4-methoxyphenyl),boronic acid, 98%, 98% (CAS 175883-61-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11320D-100mg |
| cas | 175883-61-1 |
| size | 100mg |
| availability | 100g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 362.00 Pln | |
| Chemat | 5g | 1211.60 Pln | |
| Chemat | 10g | 1806.80 Pln | |
| Chemat | 25g | 3942.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3,5-dichloro-4-methoxyphenyl)boronic acid (CAS 175883-61-1) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (3,5-dichloro-4-methoxyphenyl)boronic acid. InChIKey: JHCLSOGJYUVJNQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (3,5-dichloro-4-methoxyphenyl)boronic acid |
| InChIKey | JHCLSOGJYUVJNQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OC)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,5-Dichloro-4-methoxyphenylboronic acid, (3,5-dichloro-4-methoxyphenyl)boronic acid, 3,5-Dichloro-4-methoxybenzeneboronic acid, (3,5-Dichloro-4-methoxyphenyl);boronic acid, (3,5-dichloro-4-methoxy-phenyl)boronic Acid, (3,5-dichloro-4-methoxyphenyl)boronicacid, 3,5-dichloro-4-methoxybenzeneboronic acid, AldrichCPR