(3,5-Dichloro-4-methoxyphenyl)boronic acid 98%
cas: 175883-61-1 — see every product listed under this CAS number, including other names
(3,5-Dichloro-4-methoxyphenyl)boronic acid 98% (CAS 175883-61-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A828809-250mg |
| cas | 175883-61-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1560.75 Pln | |
| Ambeed | 10g | 2584.25 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A828809 |
(3,5-dichloro-4-methoxyphenyl)boronic acid (CAS 175883-61-1) is a chemical compound with the molecular formula C7H7BCl2O3 and a molecular weight of 220.84 g/mol. IUPAC name: (3,5-dichloro-4-methoxyphenyl)boronic acid. InChIKey: JHCLSOGJYUVJNQ-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O3 |
|---|---|
| Molecular weight | 220.84 g/mol |
| IUPAC name | (3,5-dichloro-4-methoxyphenyl)boronic acid |
| InChIKey | JHCLSOGJYUVJNQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OC)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,5-Dichloro-4-methoxyphenylboronic acid, (3,5-dichloro-4-methoxyphenyl)boronic acid, 3,5-Dichloro-4-methoxybenzeneboronic acid, (3,5-Dichloro-4-methoxyphenyl);boronic acid, (3,5-dichloro-4-methoxy-phenyl)boronic Acid, (3,5-dichloro-4-methoxyphenyl)boronicacid, 3,5-dichloro-4-methoxybenzeneboronic acid, AldrichCPR