cas: 208641-98-9 — see every product listed under this CAS number, including other names
(3,5-Difluoro-4-methoxyphenyl)boronic acid, 95% (CAS 208641-98-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219073-1G |
| cas | 208641-98-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 237.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(3,5-difluoro-4-methoxyphenyl)boronic acid (CAS 208641-98-9) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (3,5-difluoro-4-methoxyphenyl)boronic acid. InChIKey: JJRIEFCRGWHLES-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (3,5-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | JJRIEFCRGWHLES-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)OC)F)(O)O |
Computed by PubChem (NCBI)