cas: 208641-98-9 — see every product listed under this CAS number, including other names
(3,5-Difluoro-4-methoxyphenyl)boronic acid, 97%, 97% (CAS 208641-98-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113JT2-100mg |
| cas | 208641-98-9 |
| size | 100mg |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 25g | 1043.60 Pln | |
| Chemat | 100g | 2790.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3,5-difluoro-4-methoxyphenyl)boronic acid (CAS 208641-98-9) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (3,5-difluoro-4-methoxyphenyl)boronic acid. InChIKey: JJRIEFCRGWHLES-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (3,5-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | JJRIEFCRGWHLES-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)OC)F)(O)O |
Computed by PubChem (NCBI)